C12H19N3O3 — CID 136780950
2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 136780950) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136780950 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | COCCOCCc1nc2c(c(=O)[nH]1)CCNC2 |
| InChI | InChI=1S/C12H19N3O3/c1-17-6-7-18-5-3-11-14-10-8-13-4-2-9(10)12(16)15-11/h13H,2-8H2,1H3,(H,14,15,16) |
| InChIKey | FDLJNQCFCYVEME-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|