C16H14N4O4S2 — CID 136781771
2-ethoxy-6-nitro-4-[(Z)-[(4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136781771) has the molecular formula C16H14N4O4S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-ethoxy-6-nitro-4-[(Z)-[(4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-ethoxy-6-nitro-4-[(Z)-[(4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136781771 |
| Molecular Formula | C16H14N4O4S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 2-ethoxy-6-nitro-4-[(Z)-[(4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | CCOc1cc(/C=N\Nc2nc(-c3cccs3)cs2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H14N4O4S2/c1-2-24-13-7-10(6-12(15(13)21)20(22)23)8-17-19-16-18-11(9-26-16)14-4-3-5-25-14/h3-9,21H,2H2,1H3,(H,18,19)/b17-8- |
| InChIKey | CUSCXJFNGPFFLA-IUXPMGMMSA-N |
| XLogP | 4.33 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|