About CID 136783338
CID 136783338 (PubChem CID 136783338) has the molecular formula C15H17ClO3Si2
and a molecular weight of 336.92 g/mol.
Molecular Properties
| Compound Name | CID 136783338 |
| PubChem CID | 136783338 |
| Molecular Formula | C15H17ClO3Si2 |
| Molecular Weight | 336.92 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | — |
| SMILES | O[Si](CCc1ccc(CCl)cc1)O[Si](O)c1ccccc1 |
| InChI | InChI=1S/C15H17ClO3Si2/c16-12-14-8-6-13(7-9-14)10-11-20(17)19-21(18)15-4-2-1-3-5-15/h1-9,17-18H,10-12H2 |
| InChIKey | IHAPKKMJFNMAKD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.92 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136783338 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136783338?
The IUPAC name of CID 136783338 (CID 136783338) is not available.
What is the SMILES notation for CID 136783338?
The canonical SMILES for CID 136783338 is O[Si](CCc1ccc(CCl)cc1)O[Si](O)c1ccccc1.
What is the InChIKey of CID 136783338?
The InChIKey is IHAPKKMJFNMAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO3Si2/c16-12-14-8-6-13(7-9-14)10-11-20(17)19-21(18)15-4-2-1-3-5-15/h1-9,17-18H,10-12H2.
What are the key properties of CID 136783338?
CID 136783338 has a molecular weight of 336.92 g/mol, XLogP of 1.85, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136783338 is sourced from PubChem (CID 136783338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).