C7H9F2N3O2 — CID 136790780
4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136790780) has the molecular formula C7H9F2N3O2 and a molecular weight of 205.16 g/mol. Its IUPAC name is 4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136790780 |
| Molecular Formula | C7H9F2N3O2 |
| Molecular Weight | 205.16 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-[(3,3-difluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC(O)C(F)F)nc[nH]1 |
| InChI | InChI=1S/C7H9F2N3O2/c8-7(9)4(13)2-10-5-1-6(14)12-3-11-5/h1,3-4,7,13H,2H2,(H2,10,11,12,14) |
| InChIKey | WNGSEYUUBFTMQW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |