C7H7F3IN3O2 — CID 136790774
5-iodo-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one (PubChem CID 136790774) has the molecular formula C7H7F3IN3O2 and a molecular weight of 349.05 g/mol. Its IUPAC name is 5-iodo-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136790774 |
| Molecular Formula | C7H7F3IN3O2 |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 5-iodo-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(O)C(F)(F)F)c1I |
| InChI | InChI=1S/C7H7F3IN3O2/c8-7(9,10)3(15)1-12-5-4(11)6(16)14-2-13-5/h2-3,15H,1H2,(H2,12,13,14,16) |
| InChIKey | RGLMDRVYZNEAOM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|