C7H8F2IN3O2 — CID 136849688
4-[(2,2-difluoro-3-hydroxypropyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136849688) has the molecular formula C7H8F2IN3O2 and a molecular weight of 331.06 g/mol. Its IUPAC name is 4-[(2,2-difluoro-3-hydroxypropyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136849688 |
| Molecular Formula | C7H8F2IN3O2 |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 4-[(2,2-difluoro-3-hydroxypropyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(F)(F)CO)c1I |
| InChI | InChI=1S/C7H8F2IN3O2/c8-7(9,2-14)1-11-5-4(10)6(15)13-3-12-5/h3,14H,1-2H2,(H2,11,12,13,15) |
| InChIKey | IVJDWYPOUKAXAT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|