About Butyldimethylsilane (D6)
Butyldimethylsilane (D6) (PubChem CID 136797938) has the molecular formula C6H15Si
and a molecular weight of 121.31 g/mol.
Molecular Properties
| Compound Name | Butyldimethylsilane (D6) |
| PubChem CID | 136797938 |
| Molecular Formula | C6H15Si |
| Molecular Weight | 121.31 g/mol |
| Exact Mass | 121.13 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])[Si](CCCC)C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H15Si/c1-4-5-6-7(2)3/h4-6H2,1-3H3/i2D3,3D3 |
| InChIKey | HHSARRMUXPDGJD-XERRXZQWSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Butyldimethylsilane (D6) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butyldimethylsilane (D6)?
The IUPAC name of Butyldimethylsilane (D6) (CID 136797938) is not available.
What is the SMILES notation for Butyldimethylsilane (D6)?
The canonical SMILES for Butyldimethylsilane (D6) is [2H]C([2H])([2H])[Si](CCCC)C([2H])([2H])[2H].
What is the InChIKey of Butyldimethylsilane (D6)?
The InChIKey is HHSARRMUXPDGJD-XERRXZQWSA-N. The full InChI is InChI=1S/C6H15Si/c1-4-5-6-7(2)3/h4-6H2,1-3H3/i2D3,3D3.
What are the key properties of Butyldimethylsilane (D6)?
Butyldimethylsilane (D6) has a molecular weight of 121.31 g/mol, XLogP of 2.54, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Butyldimethylsilane (D6) is sourced from PubChem (CID 136797938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).