About CID 149163114
CID 149163114 (PubChem CID 149163114) has the molecular formula C10H25OSiY
and a molecular weight of 278.30 g/mol.
Molecular Properties
| Compound Name | CID 149163114 |
| PubChem CID | 149163114 |
| Molecular Formula | C10H25OSiY |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | — |
| SMILES | CCCC[Si](CC)CC.CCO.[Y] |
| InChI | InChI=1S/C8H19Si.C2H6O.Y/c1-4-7-8-9(5-2)6-3;1-2-3;/h4-8H2,1-3H3;3H,2H2,1H3; |
| InChIKey | AJXWXOFPAKUVGK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 149163114 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149163114?
The IUPAC name of CID 149163114 (CID 149163114) is not available.
What is the SMILES notation for CID 149163114?
The canonical SMILES for CID 149163114 is CCCC[Si](CC)CC.CCO.[Y].
What is the InChIKey of CID 149163114?
The InChIKey is AJXWXOFPAKUVGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19Si.C2H6O.Y/c1-4-7-8-9(5-2)6-3;1-2-3;/h4-8H2,1-3H3;3H,2H2,1H3;.
What are the key properties of CID 149163114?
CID 149163114 has a molecular weight of 278.30 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149163114 is sourced from PubChem (CID 149163114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).