About Triethylsilicon
Triethylsilicon (PubChem CID 6327258) has the molecular formula C6H15Si
and a molecular weight of 115.27 g/mol.
Molecular Properties
| Compound Name | Triethylsilicon |
| PubChem CID | 6327258 |
| Molecular Formula | C6H15Si |
| Molecular Weight | 115.27 g/mol |
| Exact Mass | 115.09 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)CC |
| InChI | InChI=1S/C6H15Si/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| InChIKey | QXTIBZLKQPJVII-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Triethylsilicon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Triethylsilicon?
The IUPAC name of Triethylsilicon (CID 6327258) is not available.
What is the SMILES notation for Triethylsilicon?
The canonical SMILES for Triethylsilicon is CC[Si](CC)CC.
What is the InChIKey of Triethylsilicon?
The InChIKey is QXTIBZLKQPJVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15Si/c1-4-7(5-2)6-3/h4-6H2,1-3H3.
What are the key properties of Triethylsilicon?
Triethylsilicon has a molecular weight of 115.27 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Triethylsilicon is sourced from PubChem (CID 6327258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).