About Germane, triethyl(triethylsilyl)-
Germane, triethyl(triethylsilyl)- (PubChem CID 6327593) has the molecular formula C12H30GeSi
and a molecular weight of 275.07 g/mol.
Molecular Properties
| Compound Name | Germane, triethyl(triethylsilyl)- |
| PubChem CID | 6327593 |
| Molecular Formula | C12H30GeSi |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | — |
| SMILES | CC[Ge](CC)CC.CC[Si](CC)CC |
| InChI | InChI=1S/C6H15Ge.C6H15Si/c2*1-4-7(5-2)6-3/h2*4-6H2,1-3H3 |
| InChIKey | WDHKHPQIAHBJEY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Germane, triethyl(triethylsilyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Germane, triethyl(triethylsilyl)-?
The IUPAC name of Germane, triethyl(triethylsilyl)- (CID 6327593) is not available.
What is the SMILES notation for Germane, triethyl(triethylsilyl)-?
The canonical SMILES for Germane, triethyl(triethylsilyl)- is CC[Ge](CC)CC.CC[Si](CC)CC.
What is the InChIKey of Germane, triethyl(triethylsilyl)-?
The InChIKey is WDHKHPQIAHBJEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15Ge.C6H15Si/c2*1-4-7(5-2)6-3/h2*4-6H2,1-3H3.
What are the key properties of Germane, triethyl(triethylsilyl)-?
Germane, triethyl(triethylsilyl)- has a molecular weight of 275.07 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Germane, triethyl(triethylsilyl)- is sourced from PubChem (CID 6327593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).