About CID 141050795
CID 141050795 (PubChem CID 141050795) has the molecular formula C9H22SiTm-
and a molecular weight of 327.30 g/mol.
Molecular Properties
| Compound Name | CID 141050795 |
| PubChem CID | 141050795 |
| Molecular Formula | C9H22SiTm- |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | — |
| SMILES | CCC[Si](CC)CC.[CH2-]C.[Tm] |
| InChI | InChI=1S/C7H17Si.C2H5.Tm/c1-4-7-8(5-2)6-3;1-2;/h4-7H2,1-3H3;1H2,2H3;/q;-1; |
| InChIKey | VYYFUVUWDWGGJN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 141050795 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 141050795?
The IUPAC name of CID 141050795 (CID 141050795) is not available.
What is the SMILES notation for CID 141050795?
The canonical SMILES for CID 141050795 is CCC[Si](CC)CC.[CH2-]C.[Tm].
What is the InChIKey of CID 141050795?
The InChIKey is VYYFUVUWDWGGJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17Si.C2H5.Tm/c1-4-7-8(5-2)6-3;1-2;/h4-7H2,1-3H3;1H2,2H3;/q;-1;.
What are the key properties of CID 141050795?
CID 141050795 has a molecular weight of 327.30 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 141050795 is sourced from PubChem (CID 141050795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).