C21H18ClN5O3 — CID 136798128
(7R)-N-(4-chlorophenyl)-2,5-dimethyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136798128) has the molecular formula C21H18ClN5O3 and a molecular weight of 423.86 g/mol. Its IUPAC name is (7R)-N-(4-chlorophenyl)-2,5-dimethyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-N-(4-chlorophenyl)-2,5-dimethyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136798128 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (7R)-N-(4-chlorophenyl)-2,5-dimethyl-7-(4-nitrophenyl)-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(Cl)cc2)[C@@H](c2ccc([N+](=O)[O-])cc2)n2nc(C)cc2N1 |
| InChI | InChI=1S/C21H18ClN5O3/c1-12-11-18-23-13(2)19(21(28)24-16-7-5-15(22)6-8-16)20(26(18)25-12)14-3-9-17(10-4-14)27(29)30/h3-11,20,23H,1-2H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | VTSQSZYBPIIICA-HXUWFJFHSA-N |
| XLogP | 4.68 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|