C20H24N2O3 — CID 136800596
2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(2-methoxyphenyl)cyclohex-2-en-1-one (PubChem CID 136800596) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(2-methoxyphenyl)cyclohex-2-en-1-one.
| Compound Name | 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(2-methoxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 136800596 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-3-hydroxy-5-(2-methoxyphenyl)cyclohex-2-en-1-one |
| SMILES | COc1ccccc1C1CC(=O)C(C2=N[C@H]3CCCC[C@@H]3N2)=C(O)C1 |
| InChI | InChI=1S/C20H24N2O3/c1-25-18-9-5-2-6-13(18)12-10-16(23)19(17(24)11-12)20-21-14-7-3-4-8-15(14)22-20/h2,5-6,9,12,14-15,23H,3-4,7-8,10-11H2,1H3,(H,21,22)/t12?,14-,15-/m0/s1 |
| InChIKey | DASBLCAZRVLZMQ-ZRNAQANOSA-N |
| XLogP | 3.27 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |