C21H26N2O4 — CID 135645250
2-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-5-(2,4-dimethoxyphenyl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 135645250) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-5-(2,4-dimethoxyphenyl)-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-5-(2,4-dimethoxyphenyl)-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135645250 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl)-5-(2,4-dimethoxyphenyl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | COc1ccc(C2CC(=O)C(C3=NC4CCCCC4N3)=C(O)C2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-26-13-7-8-14(19(11-13)27-2)12-9-17(24)20(18(25)10-12)21-22-15-5-3-4-6-16(15)23-21/h7-8,11-12,15-16,24H,3-6,9-10H2,1-2H3,(H,22,23) |
| InChIKey | KFAORHLZGMJTHF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |