C8H11ClN4O3 — CID 136805709
2-[2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]ethoxy]acetamide (PubChem CID 136805709) has the molecular formula C8H11ClN4O3 and a molecular weight of 246.65 g/mol. Its IUPAC name is 2-[2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]ethoxy]acetamide.
| Compound Name | 2-[2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 136805709 |
| Molecular Formula | C8H11ClN4O3 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-[2-[(5-chloro-6-oxo-1H-pyrimidin-4-yl)amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H11ClN4O3/c9-6-7(12-4-13-8(6)15)11-1-2-16-3-5(10)14/h4H,1-3H2,(H2,10,14)(H2,11,12,13,15) |
| InChIKey | QVBJFGHTXHTYFG-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|