C36H41N3O4 — CID 136808016
[4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate (PubChem CID 136808016) has the molecular formula C36H41N3O4 and a molecular weight of 579.74 g/mol. Its IUPAC name is [4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 136808016 |
| Molecular Formula | C36H41N3O4 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | [4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]phenyl] (E)-3-(4-decoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(/N=C/c3c(C)[nH]n(-c4ccccc4)c3=O)cc2)cc1 |
| InChI | InChI=1S/C36H41N3O4/c1-3-4-5-6-7-8-9-13-26-42-32-21-16-29(17-22-32)18-25-35(40)43-33-23-19-30(20-24-33)37-27-34-28(2)38-39(36(34)41)31-14-11-10-12-15-31/h10-12,14-25,27,38H,3-9,13,26H2,1-2H3/b25-18+,37-27+ |
| InChIKey | GXLBEEOMAJJTGS-LNVXUJDHSA-N |
| XLogP | 8.36 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|