C32H37NO3 — CID 132575740
[4-[(3,4-dimethylphenyl)methylideneamino]phenyl] (E)-3-(4-octoxyphenyl)prop-2-enoate (PubChem CID 132575740) has the molecular formula C32H37NO3 and a molecular weight of 483.65 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)methylideneamino]phenyl] (E)-3-(4-octoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(3,4-dimethylphenyl)methylideneamino]phenyl] (E)-3-(4-octoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 132575740 |
| Molecular Formula | C32H37NO3 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)methylideneamino]phenyl] (E)-3-(4-octoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(/N=C/c3ccc(C)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C32H37NO3/c1-4-5-6-7-8-9-22-35-30-17-12-27(13-18-30)14-21-32(34)36-31-19-15-29(16-20-31)33-24-28-11-10-25(2)26(3)23-28/h10-21,23-24H,4-9,22H2,1-3H3/b21-14+,33-24+ |
| InChIKey | UEDLLWZHYKFDHF-JRABIYHJSA-N |
| XLogP | 8.41 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|