C13H20O2 — CID 13680808
2,2,7,7-Tetramethyl-3,4,6,8-tetrahydrochromen-5-one (PubChem CID 13680808) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-3,4,6,8-tetrahydrochromen-5-one.
| Compound Name | 2,2,7,7-Tetramethyl-3,4,6,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 13680808 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2,2,7,7-tetramethyl-3,4,6,8-tetrahydrochromen-5-one |
| SMILES | CC1(CCC2=C(O1)CC(CC2=O)(C)C)C |
| InChI | InChI=1S/C13H20O2/c1-12(2)7-10(14)9-5-6-13(3,4)15-11(9)8-12/h5-8H2,1-4H3 |
| InChIKey | QEKZDSPQBSLKPT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | 334 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |