C23H24BrN5O3S — CID 136808303
2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 136808303) has the molecular formula C23H24BrN5O3S and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136808303 |
| Molecular Formula | C23H24BrN5O3S |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | C=C(C)Cn1c(SCC(=O)N/N=C\c2ccc(O)c(OCC)c2)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H24BrN5O3S/c1-4-32-20-11-16(5-10-19(20)30)12-25-26-21(31)14-33-23-28-27-22(29(23)13-15(2)3)17-6-8-18(24)9-7-17/h5-12,30H,2,4,13-14H2,1,3H3,(H,26,31)/b25-12- |
| InChIKey | MBWPXEMYRTWYHZ-ROTLSHHCSA-N |
| XLogP | 4.63 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|