C25H29BrN6OS — CID 4207876
2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide (PubChem CID 4207876) has the molecular formula C25H29BrN6OS and a molecular weight of 541.52 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4207876 |
| Molecular Formula | C25H29BrN6OS |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[4-(diethylamino)phenyl]methylideneamino]acetamide |
| SMILES | C=C(C)Cn1c(SCC(=O)NN=Cc2ccc(N(CC)CC)cc2)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H29BrN6OS/c1-5-31(6-2)22-13-7-19(8-14-22)15-27-28-23(33)17-34-25-30-29-24(32(25)16-18(3)4)20-9-11-21(26)12-10-20/h7-15H,3,5-6,16-17H2,1-2,4H3,(H,28,33) |
| InChIKey | LSGSOKBVLJPVDA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|