C21H20BrN5O2S — CID 4620472
2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 4620472) has the molecular formula C21H20BrN5O2S and a molecular weight of 486.40 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4620472 |
| Molecular Formula | C21H20BrN5O2S |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-4-(2-methylprop-2-enyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | C=C(C)Cn1c(SCC(=O)NN=Cc2ccc(O)cc2)nnc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H20BrN5O2S/c1-14(2)12-27-20(16-5-7-17(22)8-6-16)25-26-21(27)30-13-19(29)24-23-11-15-3-9-18(28)10-4-15/h3-11,28H,1,12-13H2,2H3,(H,24,29) |
| InChIKey | YTUFQRXWRUUAFQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|