C12H13FN2O2 — CID 136809747
2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol (PubChem CID 136809747) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol.
| Compound Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol |
|---|---|
| PubChem CID | 136809747 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol |
| SMILES | CC(C)(C)c1noc(-c2ccc(F)cc2O)n1 |
| InChI | InChI=1S/C12H13FN2O2/c1-12(2,3)11-14-10(17-15-11)8-5-4-7(13)6-9(8)16/h4-6,16H,1-3H3 |
| InChIKey | KHDKKHPFXIGUJN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |