C13H21N5O2 — CID 136811783
N'-hydroxy-3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-2-carboximidamide (PubChem CID 136811783) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N'-hydroxy-3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136811783 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N'-hydroxy-3-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ncccc1N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C13H21N5O2/c14-13(16-20)12-11(3-1-4-15-12)18-6-2-5-17(7-8-18)9-10-19/h1,3-4,19-20H,2,5-10H2,(H2,14,16) |
| InChIKey | OLUGSXXEADXWNG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|