C14H22N4OS — CID 107223114
2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-4-methylpyridine-3-carbothioamide (PubChem CID 107223114) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-4-methylpyridine-3-carbothioamide.
| Compound Name | 2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-4-methylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107223114 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-4-methylpyridine-3-carbothioamide |
| SMILES | Cc1ccnc(N2CCCN(CCO)CC2)c1C(N)=S |
| InChI | InChI=1S/C14H22N4OS/c1-11-3-4-16-14(12(11)13(15)20)18-6-2-5-17(7-8-18)9-10-19/h3-4,19H,2,5-10H2,1H3,(H2,15,20) |
| InChIKey | XIQMVPJFYYLBFE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|