C16H21N3O2 — CID 106541481
1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]isoquinolin-7-ol (PubChem CID 106541481) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]isoquinolin-7-ol.
| Compound Name | 1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 106541481 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]isoquinolin-7-ol |
| SMILES | OCCN1CCCN(c2nccc3ccc(O)cc23)CC1 |
| InChI | InChI=1S/C16H21N3O2/c20-11-10-18-6-1-7-19(9-8-18)16-15-12-14(21)3-2-13(15)4-5-17-16/h2-5,12,20-21H,1,6-11H2 |
| InChIKey | DGWMELIKBHNXCO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |