C25H23F3N6O — CID 136814187
(5R,7R)-5-(4-methylphenyl)-N-[(4-pyrazol-1-ylphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136814187) has the molecular formula C25H23F3N6O and a molecular weight of 480.49 g/mol. Its IUPAC name is (5R,7R)-5-(4-methylphenyl)-N-[(4-pyrazol-1-ylphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5R,7R)-5-(4-methylphenyl)-N-[(4-pyrazol-1-ylphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136814187 |
| Molecular Formula | C25H23F3N6O |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (5R,7R)-5-(4-methylphenyl)-N-[(4-pyrazol-1-ylphenyl)methyl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc([C@H]2C[C@H](C(F)(F)F)n3nc(C(=O)NCc4ccc(-n5cccn5)cc4)cc3N2)cc1 |
| InChI | InChI=1S/C25H23F3N6O/c1-16-3-7-18(8-4-16)20-13-22(25(26,27)28)34-23(31-20)14-21(32-34)24(35)29-15-17-5-9-19(10-6-17)33-12-2-11-30-33/h2-12,14,20,22,31H,13,15H2,1H3,(H,29,35)/t20-,22-/m1/s1 |
| InChIKey | CFTADWVZMPWGSR-IFMALSPDSA-N |
| XLogP | 4.97 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |