C56H54Cl4N8O8S4 — CID 136814596
2-chloro-N-propyl-3-[10,15,20-tris[2-chloro-3-(propylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide (PubChem CID 136814596) has the molecular formula C56H54Cl4N8O8S4 and a molecular weight of 1237.18 g/mol. Its IUPAC name is 2-chloro-N-propyl-3-[10,15,20-tris[2-chloro-3-(propylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide.
| Compound Name | 2-chloro-N-propyl-3-[10,15,20-tris[2-chloro-3-(propylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 136814596 |
| Molecular Formula | C56H54Cl4N8O8S4 |
| Molecular Weight | 1237.18 g/mol |
| Exact Mass | 1234.17 |
| IUPAC Name | 2-chloro-N-propyl-3-[10,15,20-tris[2-chloro-3-(propylsulfamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1cccc(-c2c3nc(c(-c4cccc(S(=O)(=O)NCCC)c4Cl)c4ccc([nH]4)c(-c4cccc(S(=O)(=O)NCCC)c4Cl)c4nc(c(-c5cccc(S(=O)(=O)NCCC)c5Cl)c5ccc2[nH]5)C=C4)C=C3)c1Cl |
| InChI | InChI=1S/C56H54Cl4N8O8S4/c1-5-29-61-77(69,70)45-17-9-13-33(53(45)57)49-37-21-23-39(65-37)50(34-14-10-18-46(54(34)58)78(71,72)62-30-6-2)41-25-27-43(67-41)52(36-16-12-20-48(56(36)60)80(75,76)64-32-8-4)44-28-26-42(68-44)51(40-24-22-38(49)66-40)35-15-11-19-47(55(35)59)79(73,74)63-31-7-3/h9-28,61-65,68H,5-8,29-32H2,1-4H3/b49-37-,49-38-,50-39-,50-41-,51-40-,51-42-,52-43-,52-44- |
| InChIKey | JJWYHQLBPHADOR-QURNHSOUSA-N |
| XLogP | 12.69 |
| TPSA | 242.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1237.18 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |