C44H22Cl4F4N4O12S4 — CID 136823380
2-chloro-4-fluoro-3-[10,15,20-tris(2-chloro-6-fluoro-3-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid (PubChem CID 136823380) has the molecular formula C44H22Cl4F4N4O12S4 and a molecular weight of 1144.75 g/mol. Its IUPAC name is 2-chloro-4-fluoro-3-[10,15,20-tris(2-chloro-6-fluoro-3-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid.
| Compound Name | 2-chloro-4-fluoro-3-[10,15,20-tris(2-chloro-6-fluoro-3-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136823380 |
| Molecular Formula | C44H22Cl4F4N4O12S4 |
| Molecular Weight | 1144.75 g/mol |
| Exact Mass | 1141.88 |
| IUPAC Name | 2-chloro-4-fluoro-3-[10,15,20-tris(2-chloro-6-fluoro-3-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(F)c(-c2c3nc(c(-c4c(F)ccc(S(=O)(=O)O)c4Cl)c4ccc([nH]4)c(-c4c(F)ccc(S(=O)(=O)O)c4Cl)c4nc(c(-c5c(F)ccc(S(=O)(=O)O)c5Cl)c5ccc2[nH]5)C=C4)C=C3)c1Cl |
| InChI | InChI=1S/C44H22Cl4F4N4O12S4/c45-41-29(69(57,58)59)13-1-17(49)33(41)37-21-5-7-23(53-21)38(34-18(50)2-14-30(42(34)46)70(60,61)62)25-9-11-27(55-25)40(36-20(52)4-16-32(44(36)48)72(66,67)68)28-12-10-26(56-28)39(24-8-6-22(37)54-24)35-19(51)3-15-31(43(35)47)71(63,64)65/h1-16,53,56H,(H,57,58,59)(H,60,61,62)(H,63,64,65)(H,66,67,68)/b37-21+,37-22+,38-23+,38-25+,39-24+,39-26+,40-27+,40-28+ |
| InChIKey | JWNUWMJUXGXMIK-GZNZDWAPSA-N |
| XLogP | 11.48 |
| TPSA | 274.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1144.75 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|