C12H10N2O3S — CID 136828202
6-hydroxy-5-(C-methyl-N-phenylcarbonimidoyl)-1,3-thiazine-2,4-dione (PubChem CID 136828202) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is 6-hydroxy-5-(C-methyl-N-phenylcarbonimidoyl)-1,3-thiazine-2,4-dione.
| Compound Name | 6-hydroxy-5-(C-methyl-N-phenylcarbonimidoyl)-1,3-thiazine-2,4-dione |
|---|---|
| PubChem CID | 136828202 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 6-hydroxy-5-(C-methyl-N-phenylcarbonimidoyl)-1,3-thiazine-2,4-dione |
| SMILES | C/C(=N\c1ccccc1)c1c(O)sc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H10N2O3S/c1-7(13-8-5-3-2-4-6-8)9-10(15)14-12(17)18-11(9)16/h2-6,16H,1H3,(H,14,15,17)/b13-7+ |
| InChIKey | FBWMEQMBOMXTKB-NTUHNPAUSA-N |
| XLogP | 1.64 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|