C14H15NO3 — CID 135604523
4-hydroxy-2-methyl-5-(C-methyl-N-phenylcarbonimidoyl)-2,3-dihydropyran-6-one (PubChem CID 135604523) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-5-(C-methyl-N-phenylcarbonimidoyl)-2,3-dihydropyran-6-one.
| Compound Name | 4-hydroxy-2-methyl-5-(C-methyl-N-phenylcarbonimidoyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 135604523 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-hydroxy-2-methyl-5-(C-methyl-N-phenylcarbonimidoyl)-2,3-dihydropyran-6-one |
| SMILES | C/C(=N\c1ccccc1)C1=C(O)CC(C)OC1=O |
| InChI | InChI=1S/C14H15NO3/c1-9-8-12(16)13(14(17)18-9)10(2)15-11-6-4-3-5-7-11/h3-7,9,16H,8H2,1-2H3/b15-10+ |
| InChIKey | GDQWCYQWJQKMGT-XNTDXEJSSA-N |
| XLogP | 2.93 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|