C14H23N3OS — CID 136830005
N-cyclopropyl-2-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide (PubChem CID 136830005) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is N-cyclopropyl-2-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide.
| Compound Name | N-cyclopropyl-2-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide |
|---|---|
| PubChem CID | 136830005 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-cyclopropyl-2-(3-thia-1-azaspiro[4.5]decan-2-ylideneamino)propanamide |
| SMILES | CC(/N=C1/NC2(CCCCC2)CS1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H23N3OS/c1-10(12(18)16-11-5-6-11)15-13-17-14(9-19-13)7-3-2-4-8-14/h10-11H,2-9H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | NNDVJBYLUUTQJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|