C13H18N6O — CID 136839709
7-(1-methylpyrazol-4-yl)-2-(oxolan-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136839709) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 7-(1-methylpyrazol-4-yl)-2-(oxolan-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(1-methylpyrazol-4-yl)-2-(oxolan-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136839709 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 7-(1-methylpyrazol-4-yl)-2-(oxolan-2-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cn1cc(C2CCNc3nc(C4CCCO4)nn32)cn1 |
| InChI | InChI=1S/C13H18N6O/c1-18-8-9(7-15-18)10-4-5-14-13-16-12(17-19(10)13)11-3-2-6-20-11/h7-8,10-11H,2-6H2,1H3,(H,14,16,17) |
| InChIKey | HTWOZYQHWZWFTG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |