C14H17N3O — CID 136839931
7-(4-ethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine (PubChem CID 136839931) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 7-(4-ethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine.
| Compound Name | 7-(4-ethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 136839931 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 7-(4-ethoxyphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrimidine |
| SMILES | CCOc1ccc(C2CCn3ccnc3N2)cc1 |
| InChI | InChI=1S/C14H17N3O/c1-2-18-12-5-3-11(4-6-12)13-7-9-17-10-8-15-14(17)16-13/h3-6,8,10,13H,2,7,9H2,1H3,(H,15,16) |
| InChIKey | LZFJBOKMXVLPLG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |