C14H18N4O2 — CID 136841478
ethyl 8-amino-4-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazole-3-carboxylate (PubChem CID 136841478) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 8-amino-4-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazole-3-carboxylate.
| Compound Name | ethyl 8-amino-4-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazole-3-carboxylate |
|---|---|
| PubChem CID | 136841478 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | ethyl 8-amino-4-methyl-1,2,3,4-tetrahydropyrimido[1,2-b]indazole-3-carboxylate |
| SMILES | CCOC(=O)C1CNc2c3ccc(N)cc3nn2C1C |
| InChI | InChI=1S/C14H18N4O2/c1-3-20-14(19)11-7-16-13-10-5-4-9(15)6-12(10)17-18(13)8(11)2/h4-6,8,11,16H,3,7,15H2,1-2H3 |
| InChIKey | IXHVSEUYSHTHMW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|