C16H15FN4 — CID 136841492
4-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-8-amine (PubChem CID 136841492) has the molecular formula C16H15FN4 and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-8-amine.
| Compound Name | 4-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-8-amine |
|---|---|
| PubChem CID | 136841492 |
| Molecular Formula | C16H15FN4 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-(3-fluorophenyl)-1,2,3,4-tetrahydropyrimido[1,2-b]indazol-8-amine |
| SMILES | Nc1ccc2c3n(nc2c1)C(c1cccc(F)c1)CCN3 |
| InChI | InChI=1S/C16H15FN4/c17-11-3-1-2-10(8-11)15-6-7-19-16-13-5-4-12(18)9-14(13)20-21(15)16/h1-5,8-9,15,19H,6-7,18H2 |
| InChIKey | VGXNHYLIMLZWCL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|