C15H12F2N4 — CID 136840841
6-(3,5-difluorophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene (PubChem CID 136840841) has the molecular formula C15H12F2N4 and a molecular weight of 286.28 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene.
| Compound Name | 6-(3,5-difluorophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene |
|---|---|
| PubChem CID | 136840841 |
| Molecular Formula | C15H12F2N4 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 6-(3,5-difluorophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene |
| SMILES | Fc1cc(F)cc(C2CCNc3c4cccnc4nn32)c1 |
| InChI | InChI=1S/C15H12F2N4/c16-10-6-9(7-11(17)8-10)13-3-5-19-15-12-2-1-4-18-14(12)20-21(13)15/h1-2,4,6-8,13,19H,3,5H2 |
| InChIKey | KQSSEIQUDBIGBZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |