C16H16N4 — CID 136840865
11-methyl-6-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene (PubChem CID 136840865) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 11-methyl-6-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene.
| Compound Name | 11-methyl-6-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene |
|---|---|
| PubChem CID | 136840865 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 11-methyl-6-phenyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,8,10,12-tetraene |
| SMILES | Cc1ccc2c3n(nc2n1)C(c1ccccc1)CCN3 |
| InChI | InChI=1S/C16H16N4/c1-11-7-8-13-15(18-11)19-20-14(9-10-17-16(13)20)12-5-3-2-4-6-12/h2-8,14,17H,9-10H2,1H3 |
| InChIKey | NUJMFPRSJAAKSI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |