C11H16F3N3O2 — CID 136842417
4-amino-5-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842417) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 4-amino-5-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-5-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842417 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-amino-5-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | CCCc1c(N)nc(CCOCC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H16F3N3O2/c1-2-3-7-9(15)16-8(17-10(7)18)4-5-19-6-11(12,13)14/h2-6H2,1H3,(H3,15,16,17,18) |
| InChIKey | HXVBYBJFCXVPSB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|