C21H19ClFN5O — CID 136842813
(7R)-7-(2-chloro-6-fluorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136842813) has the molecular formula C21H19ClFN5O and a molecular weight of 411.87 g/mol. Its IUPAC name is (7R)-7-(2-chloro-6-fluorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7R)-7-(2-chloro-6-fluorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136842813 |
| Molecular Formula | C21H19ClFN5O |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (7R)-7-(2-chloro-6-fluorophenyl)-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)[C@H](c2c(F)cccc2Cl)n2ncnc2N1 |
| InChI | InChI=1S/C21H19ClFN5O/c1-11-7-8-16(12(2)9-11)27-20(29)17-13(3)26-21-24-10-25-28(21)19(17)18-14(22)5-4-6-15(18)23/h4-10,19H,1-3H3,(H,27,29)(H,24,25,26)/t19-/m1/s1 |
| InChIKey | QIJHMESSIGAHHT-LJQANCHMSA-N |
| XLogP | 4.62 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |