C22H20ClF2N5O2 — CID 135656880
7-[5-chloro-2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135656880) has the molecular formula C22H20ClF2N5O2 and a molecular weight of 459.88 g/mol. Its IUPAC name is 7-[5-chloro-2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[5-chloro-2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135656880 |
| Molecular Formula | C22H20ClF2N5O2 |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 7-[5-chloro-2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2cc(Cl)ccc2OC(F)F)n2ncnc2N1 |
| InChI | InChI=1S/C22H20ClF2N5O2/c1-11-4-6-16(12(2)8-11)29-20(31)18-13(3)28-22-26-10-27-30(22)19(18)15-9-14(23)5-7-17(15)32-21(24)25/h4-10,19,21H,1-3H3,(H,29,31)(H,26,27,28) |
| InChIKey | JZBGKCYGKGBUNZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |