C23H23F2N5O2S — CID 136878254
(7S)-7-[2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-2-methylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 136878254) has the molecular formula C23H23F2N5O2S and a molecular weight of 471.53 g/mol. Its IUPAC name is (7S)-7-[2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-2-methylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | (7S)-7-[2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-2-methylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 136878254 |
| Molecular Formula | C23H23F2N5O2S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (7S)-7-[2-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-5-methyl-2-methylsulfanyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CSc1nc2n(n1)[C@@H](c1ccccc1OC(F)F)C(C(=O)Nc1ccc(C)cc1C)=C(C)N2 |
| InChI | InChI=1S/C23H23F2N5O2S/c1-12-9-10-16(13(2)11-12)27-20(31)18-14(3)26-22-28-23(33-4)29-30(22)19(18)15-7-5-6-8-17(15)32-21(24)25/h5-11,19,21H,1-4H3,(H,27,31)(H,26,28,29)/t19-/m0/s1 |
| InChIKey | PBKHTEVQSYQDNO-IBGZPJMESA-N |
| XLogP | 5.15 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |