C9H13IN4O — CID 136842976
5-iodo-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 136842976) has the molecular formula C9H13IN4O and a molecular weight of 320.13 g/mol. Its IUPAC name is 5-iodo-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842976 |
| Molecular Formula | C9H13IN4O |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 5-iodo-4-[(3S)-3-methylpiperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | C[C@H]1CN(c2nc[nH]c(=O)c2I)CCN1 |
| InChI | InChI=1S/C9H13IN4O/c1-6-4-14(3-2-11-6)8-7(10)9(15)13-5-12-8/h5-6,11H,2-4H2,1H3,(H,12,13,15)/t6-/m0/s1 |
| InChIKey | NTSWZUTVJLIHFT-LURJTMIESA-N |
| XLogP | 0.17 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|