C16H22N6O2 — CID 136844457
4-[4-[[2-(dimethylamino)pyrimidin-5-yl]methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136844457) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-[4-[[2-(dimethylamino)pyrimidin-5-yl]methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[4-[[2-(dimethylamino)pyrimidin-5-yl]methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136844457 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-[4-[[2-(dimethylamino)pyrimidin-5-yl]methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C2CN(Cc3cnc(N(C)C)nc3)CCO2)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H22N6O2/c1-11-19-13(6-15(23)20-11)14-10-22(4-5-24-14)9-12-7-17-16(18-8-12)21(2)3/h6-8,14H,4-5,9-10H2,1-3H3,(H,19,20,23) |
| InChIKey | NYNHOBAMKIUYKQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |