C18H21N3O5 — CID 137052957
2-[2-[[(2S)-2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)morpholin-4-yl]methyl]phenoxy]acetic acid (PubChem CID 137052957) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[2-[[(2S)-2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)morpholin-4-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[(2S)-2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)morpholin-4-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 137052957 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[2-[[(2S)-2-(2-methyl-6-oxo-1H-pyrimidin-4-yl)morpholin-4-yl]methyl]phenoxy]acetic acid |
| SMILES | Cc1nc([C@@H]2CN(Cc3ccccc3OCC(=O)O)CCO2)cc(=O)[nH]1 |
| InChI | InChI=1S/C18H21N3O5/c1-12-19-14(8-17(22)20-12)16-10-21(6-7-25-16)9-13-4-2-3-5-15(13)26-11-18(23)24/h2-5,8,16H,6-7,9-11H2,1H3,(H,23,24)(H,19,20,22)/t16-/m0/s1 |
| InChIKey | OAEAVRJHAWMPIU-INIZCTEOSA-N |
| XLogP | 1.12 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |