C15H19N5O4 — CID 157017908
2-[2-[[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methyl]phenoxy]acetic acid (PubChem CID 157017908) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[2-[[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 157017908 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-[2-[[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methyl]phenoxy]acetic acid |
| SMILES | Cn1nnc(C2CN(Cc3ccccc3OCC(=O)O)CCO2)n1 |
| InChI | InChI=1S/C15H19N5O4/c1-19-17-15(16-18-19)13-9-20(6-7-23-13)8-11-4-2-3-5-12(11)24-10-14(21)22/h2-5,13H,6-10H2,1H3,(H,21,22) |
| InChIKey | OAMRWVQXDKDPPG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |