C17H25N5O2 — CID 137030463
4-[(2R)-4-[(2-butyl-1H-imidazol-5-yl)methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 137030463) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[(2R)-4-[(2-butyl-1H-imidazol-5-yl)methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2R)-4-[(2-butyl-1H-imidazol-5-yl)methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137030463 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[(2R)-4-[(2-butyl-1H-imidazol-5-yl)methyl]morpholin-2-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | CCCCc1ncc(CN2CCO[C@@H](c3cc(=O)[nH]c(C)n3)C2)[nH]1 |
| InChI | InChI=1S/C17H25N5O2/c1-3-4-5-16-18-9-13(21-16)10-22-6-7-24-15(11-22)14-8-17(23)20-12(2)19-14/h8-9,15H,3-7,10-11H2,1-2H3,(H,18,21)(H,19,20,23)/t15-/m1/s1 |
| InChIKey | HFTLVLRJYZEDFI-OAHLLOKOSA-N |
| XLogP | 1.72 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |