C16H18N4O4 — CID 136844551
4-[4-(2-methoxypyridine-3-carbonyl)morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136844551) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[4-(2-methoxypyridine-3-carbonyl)morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(2-methoxypyridine-3-carbonyl)morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136844551 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-[4-(2-methoxypyridine-3-carbonyl)morpholin-3-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | COc1ncccc1C(=O)N1CCOCC1c1cc(=O)[nH]c(C)n1 |
| InChI | InChI=1S/C16H18N4O4/c1-10-18-12(8-14(21)19-10)13-9-24-7-6-20(13)16(22)11-4-3-5-17-15(11)23-2/h3-5,8,13H,6-7,9H2,1-2H3,(H,18,19,21) |
| InChIKey | JSLXLKIZIYZXKZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |