C19H18N4O3 — CID 137149633
2-methyl-4-[(3R)-4-(quinoline-5-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one (PubChem CID 137149633) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-methyl-4-[(3R)-4-(quinoline-5-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[(3R)-4-(quinoline-5-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137149633 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-methyl-4-[(3R)-4-(quinoline-5-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc([C@@H]2COCCN2C(=O)c2cccc3ncccc23)cc(=O)[nH]1 |
| InChI | InChI=1S/C19H18N4O3/c1-12-21-16(10-18(24)22-12)17-11-26-9-8-23(17)19(25)14-4-2-6-15-13(14)5-3-7-20-15/h2-7,10,17H,8-9,11H2,1H3,(H,21,22,24)/t17-/m0/s1 |
| InChIKey | VYLQVQNGBTXHDH-KRWDZBQOSA-N |
| XLogP | 1.84 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |