C14H17N5O3 — CID 136844628
2-methyl-4-[4-(1-methylimidazole-2-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136844628) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-methyl-4-[4-(1-methylimidazole-2-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-[4-(1-methylimidazole-2-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136844628 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-methyl-4-[4-(1-methylimidazole-2-carbonyl)morpholin-3-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C2COCCN2C(=O)c2nccn2C)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H17N5O3/c1-9-16-10(7-12(20)17-9)11-8-22-6-5-19(11)14(21)13-15-3-4-18(13)2/h3-4,7,11H,5-6,8H2,1-2H3,(H,16,17,20) |
| InChIKey | DIYBTVVRZANRGS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |