C22H25N3O2S — CID 136844847
(5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 136844847) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136844847 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (5Z)-5-[[4-(diethylamino)-2-hydroxyphenyl]methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/C=C2\S/C(=N/c3cc(C)cc(C)c3)NC2=O)c(O)c1 |
| InChI | InChI=1S/C22H25N3O2S/c1-5-25(6-2)18-8-7-16(19(26)13-18)12-20-21(27)24-22(28-20)23-17-10-14(3)9-15(4)11-17/h7-13,26H,5-6H2,1-4H3,(H,23,24,27)/b20-12- |
| InChIKey | GGRZFPPGAOEGKW-NDENLUEZSA-N |
| XLogP | 4.75 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|